CAS 33252-54-9

3-Amino-4-methyl-2(1H)-pyridinone

Description:

3-Amino-4-methyl-2(1H)-pyridinone, with the CAS number 33252-54-9, is an organic compound characterized by its pyridinone structure, which features a pyridine ring with an amino group and a methyl group at specific positions. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the amino group that can engage in hydrogen bonding. It has potential applications in pharmaceuticals and agrochemicals due to its biological activity, which may include antimicrobial or anti-inflammatory properties. The compound's reactivity is influenced by the functional groups present, allowing for various chemical transformations. Additionally, it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties, such as melting and boiling points. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₈N₂O

InChI: InChI=1S/C6H8N2O/c1-4-2-3-8-6(9)5(4)7/h2-3H,7H2,1H3,(H,8,9)

SMILES: Cc1ccnc(c1N)O

3-AMINO-2-HYDROXY-4-PICOLINE

CAS: 33252-54-9

Formula: C₆H₈N₂O

Purity: %

Molecular weight: 124.1405

Ref: IN-DA00C749

3-Amino-2-hydroxy-4-methylpyridine

CAS: 33252-54-9

3-Amino-2-hydroxy-4-methylpyridine

Purity: ≥95%

Molecular weight: 124.14g/mol

Ref: 54-OR345516

3-Amino-4-methylpyridin-2(1H)-one

CAS: 33252-54-9

Purity: 95+%

Molecular weight: 124.1429977

Ref: 10-F605350

3-amino-4-methylpyridin-2-ol

CAS: 33252-54-9

Versatile small molecule scaffold

Formula: C₆H₈N₂O

Purity: Min. 95%

Molecular weight: 124.14 g/mol

Ref: 3D-IBA25254