CAS 33263-43-3
:4-Chloro-3-pyridinesulfonamide
Description:
4-Chloro-3-pyridinesulfonamide is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 4-position and a sulfonamide group at the 3-position contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in polar solvents, reflecting its polar functional groups. It is often utilized in medicinal chemistry and pharmaceutical research due to its potential biological activity, particularly as a sulfonamide derivative, which can exhibit antibacterial properties. The sulfonamide moiety is known for its ability to inhibit bacterial growth by interfering with folic acid synthesis. Additionally, the chlorine substituent can influence the compound's reactivity and interaction with biological targets. Safety data indicates that, like many sulfonamides, it should be handled with care due to potential toxicity and allergic reactions in sensitive individuals. Overall, 4-Chloro-3-pyridinesulfonamide is a compound of interest in various chemical and biological applications.
Formula:C5H5ClN2O2S
InChI:InChI=1S/C5H5ClN2O2S/c6-4-1-2-8-3-5(4)11(7,9)10/h1-3H,(H2,7,9,10)
InChI key:InChIKey=DGIINIBYHCODIH-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1C(Cl)=CC=NC1
Synonyms:- 3-Pyridinesulfonamide, 4-chloro-
- 4-Chloro-3-Pyridine Sulfonamide
- 4-Chloro-3-pyridinesulfonamide
- 4-Chloro-3-pyridylsulfonamide
- 4-Chloropyridine-3-Sulfamide
- 4-Chloropyridine-3-sulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Chloropyridine-3-sulfonamide
CAS:Formula:C5H5ClN2O2SPurity:98%Color and Shape:SolidMolecular weight:192.62344-Chloropyridine-3-sulphonamide
CAS:4-Chloropyridine-3-sulphonamideFormula:C5H5ClN2O2SPurity:98%Molecular weight:192.62344-Chloro-3-pyridinesulfonamide
CAS:Controlled ProductApplications 4-Chloro-3-pyridinesulfonamide is a building block that has been used as a reactant for the preparation of heterocyclic 4-substituted pyridine-3-sulfonamide derivatives as inhibitors of four isoforms of zinc enzyme carbonic anhydrase.
References Slawinski, J., et. al.: Eur. J. Med. Chem., 69, 701 (2013)Formula:C5H5ClN2O2SColor and Shape:NeatMolecular weight:192.624-Chloropyridine-3-sulfonamide
CAS:4-Chloropyridine-3-sulfonamideFormula:C5H5ClN2O2SPurity:98%Molecular weight:192.624-Chloro-3-pyridinesulfonamide
CAS:4-Chloro-3-pyridinesulfonamide is an antibacterial sulfonamide that inhibits the enzyme carbonic anhydrase. It has been shown to inhibit the growth of cancer cells in vitro and in vivo. The anticancer effect may be due to its ability to block the growth of cancer cells by interfering with DNA synthesis and inducing apoptosis, which causes cell death. 4-Chloro-3-pyridinesulfonamide also inhibits tuberculosis and tuberculostatic activity may be due to its inhibition of mycobacterium tuberculosis ribosomes. 4-Chloro-3-pyridinesulfonamide binds to the active site of bacterial anhydrase as well as human carbonic anhydrase II, blocking the conversion of CO2 into bicarbonate ions, which leads to a decrease in pH. This drug also binds to DNA and RNA, inhibiting DNA synthesis and RNA synthesis respectively, leading to cellFormula:C5H5ClN2O2SPurity:Min. 95%Color and Shape:SolidMolecular weight:192.62 g/mol4-Chloropyridine-3-sulfonamide
CAS:Formula:C5H5ClN2O2SPurity:98%Color and Shape:SolidMolecular weight:192.62





