CAS 33265-60-0

1-(2-Nitrophenyl)pyrrole

Description:

1-(2-Nitrophenyl)pyrrole is an organic compound characterized by the presence of a pyrrole ring substituted with a nitrophenyl group. The pyrrole moiety is a five-membered aromatic heterocycle containing four carbon atoms and one nitrogen atom, which contributes to its aromatic properties and reactivity. The nitrophenyl group, derived from a phenyl ring with a nitro substituent, introduces both electron-withdrawing characteristics and potential sites for further chemical reactions. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its solubility and stability in various solvents. 1-(2-Nitrophenyl)pyrrole may be used in various applications, including organic synthesis, materials science, and as a potential intermediate in the development of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the electron-deficient nature of the nitrophenyl group, making it a candidate for electrophilic substitution reactions. Safety data should be consulted, as nitro compounds can pose health risks and environmental concerns.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-12(14)10-6-2-1-5-9(10)11-7-3-4-8-11/h1-8H

SMILES: c1ccc(c(c1)n1cccc1)N(=O)=O

Synonyms:

• 1-(2-nitrophenyl)-1H-pyrrolato(2-)

1-(2-Nitrophenyl)-1H-pyrrole

CAS: 33265-60-0

Formula: C₁₀H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA003CVH

1-(2-nitrophenyl)-1H-pyrrole

CAS: 33265-60-0

1-(2-nitrophenyl)-1H-pyrrole

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 188.18g/mol

Ref: 54-OR23577

1-(2-Nitrophenyl)pyrrole

CAS: 33265-60-0

Purity: 95%

Molecular weight: 188.1860046

Ref: 10-F614554

1-(2-Nitrophenyl)pyrrole

CAS: 33265-60-0

1-(2-Nitrophenyl)pyrrole (1-NPyr) is an activated form of pyrrole that is synthesized by the Saccharomyces cerevisiae strain. It can be reduced with borohydride to produce 1-aminonitrobenzene. 1-NPyr has been shown to be used as a precursor for the synthesis of various drugs, including multidrugs and anilines. This compound is enantiopure and thermodynamically stable, making it an ideal candidate for asymmetric synthesis.

Formula: C₁₀H₈N₂O₂

Purity: Min. 95%

Molecular weight: 188.18 g/mol

Ref: 3D-IBA26560