CAS 33265-71-3

2-(1H-pyrrol-1-yl)benzonitrile

Description:

2-(1H-pyrrol-1-yl)benzonitrile, with the CAS number 33265-71-3, is an organic compound characterized by its structure, which features a pyrrole ring attached to a benzonitrile moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water. The presence of both the pyrrole and nitrile functional groups contributes to its chemical reactivity, making it a potential candidate for various synthetic applications in organic chemistry. It may also exhibit biological activity, which can be explored in pharmaceutical research. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its stability under standard laboratory conditions makes it suitable for further studies and applications in material science and drug development. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₈N₂

InChI: InChI=1/C11H8N2/c12-9-10-5-1-2-6-11(10)13-7-3-4-8-13/h1-8H

SMILES: c1ccc(c(c1)C#N)n1cccc1

Synonyms:

• 2-Pyrrol-1-ylbenzonitrile
• benzonitrile, 2-(1H-pyrrol-1-yl)-

2-(1H-Pyrrol-1-yl)benzonitrile

CAS: 33265-71-3

2-(1H-Pyrrol-1-yl)benzonitrile

Purity: ≥95%

Color and Shape: Beige Powder

Molecular weight: 168.19g/mol

Ref: 54-OR1437