CAS 3327-24-0

1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one

Description:

1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one, also known as a type of chalcone, is an organic compound characterized by its distinctive structure featuring a chalcone backbone. This compound typically exhibits a yellow to orange color, which is common among chalcones due to their conjugated double bond systems that allow for light absorption. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in medicinal chemistry. The presence of hydroxyl and methoxy groups enhances its reactivity and solubility in various solvents. Additionally, this compound may participate in various chemical reactions, such as Michael addition and aldol condensation, due to its electrophilic α,β-unsaturated carbonyl system. Its applications extend to fields such as pharmaceuticals, where it may serve as a lead compound for drug development. Overall, 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c1-19-13-9-6-12(7-10-13)8-11-16(18)14-4-2-3-5-15(14)17/h2-11,17H,1H3

SMILES: COc1ccc(cc1)C=CC(=O)c1ccccc1O

Synonyms:

• 1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one
• 2'-Hydroxy-4-methoxychalcone
• 2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)-
• 3327-24-0
• 1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one

2'-Hydroxy-4-methoxychalcone

CAS: 3327-24-0

Formula: C₁₆H₁₄O₃

Purity: >98.0%(T)(HPLC)

Color and Shape: Light orange to Yellow to Green powder to crystal

Molecular weight: 254.29

Ref: 3B-H1484

1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one

CAS: 3327-24-0

Formula: C₁₆H₁₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.2806

Ref: IN-DA00BZCG

1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one

CAS: 3327-24-0

1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one

Purity: 98%

Molecular weight: 254.28g/mol

Ref: 54-OR26343

2'-Hydroxy-4-methoxychalcone

CAS: 3327-24-0

2'-Hydroxy-4-methoxychalcone is a flavonoid derivative, which is primarily synthesized from chalcone structures that are naturally found in various plant sources. These compounds are well known in the realm of natural products chemistry for their extensive range of biological activities. The mode of action of 2'-Hydroxy-4-methoxychalcone involves modulation of various cellular pathways, including inhibition of enzyme activity and interference with cellular signaling mechanisms. Its antioxidative properties are of particular interest due to the potential application in combatting oxidative stress-related diseases.

Formula: C₁₆H₁₄O₃

Purity: Min. 95%

Molecular weight: 254.28 g/mol

Ref: 3D-FH66244

2′-HYDROXY-4-METHOXYCHALCONE

CAS: 3327-24-0

Purity: 98%

Molecular weight: 254.2850037

Ref: 10-F801530