CAS 3327-24-0: 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one

Description:1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one, also known as a type of chalcone, is an organic compound characterized by its distinctive structure featuring a chalcone backbone. This compound typically exhibits a yellow to orange color, which is common among chalcones due to their conjugated double bond systems that allow for light absorption. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in medicinal chemistry. The presence of hydroxyl and methoxy groups enhances its reactivity and solubility in various solvents. Additionally, this compound may participate in various chemical reactions, such as Michael addition and aldol condensation, due to its electrophilic α,β-unsaturated carbonyl system. Its applications extend to fields such as pharmaceuticals, where it may serve as a lead compound for drug development. Overall, 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula:C₁₆H₁₄O₃

InChI:InChI=1/C16H14O3/c1-19-13-9-6-12(7-10-13)8-11-16(18)14-4-2-3-5-15(14)17/h2-11,17H,1H3

Synonyms:
1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one
2'-Hydroxy-4-methoxychalcone
2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)-
3327-24-0
1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2'-Hydroxy-4-methoxychalcone REF: 3B-H1484CAS: 3327-24-0	>98.0%(T)(HPLC)	82.00 €~271.00 €	Tue 08 Apr 25
2'-HYDROXY-4-METHOXYCHALCONE REF: IN-DA00BZCGCAS: 3327-24-0	98%	54.00 €~509.00 €	Tue 15 Apr 25
1-(2-Hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one REF: 54-OR26343CAS: 3327-24-0	- - -	52.00 €~684.00 €	Wed 16 Apr 25
2'-Hydroxy-4-methoxychalcone REF: 3D-FH66244CAS: 3327-24-0	Min. 95%	147.00 €~1,009.00 €	Mon 28 Apr 25