CAS 3328-77-6

1-(2,4-dihydroxy-5-nitrophenyl)ethanone

Description:

1-(2,4-Dihydroxy-5-nitrophenyl)ethanone, also known by its CAS number 3328-77-6, is an organic compound characterized by its phenolic structure and the presence of both hydroxyl and nitro functional groups. This compound features a ketone group attached to a phenolic ring, which contributes to its reactivity and potential applications in various chemical reactions. The presence of two hydroxyl groups at the 2 and 4 positions enhances its solubility in polar solvents and increases its potential for hydrogen bonding. The nitro group at the 5 position introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. Additionally, the compound's structural features suggest it may participate in various chemical transformations, including substitution and oxidation reactions. Overall, 1-(2,4-dihydroxy-5-nitrophenyl)ethanone is a versatile compound with potential applications in both synthetic chemistry and biological studies.

Formula: C₈H₇NO₅

InChI: InChI=1/C8H7NO5/c1-4(10)5-2-6(9(13)14)8(12)3-7(5)11/h2-3,11-12H,1H3

SMILES: CC(=O)c1cc(c(cc1O)O)N(=O)=O

2',4'-Dihydroxy-5'-nitroacetophenone

CAS: 3328-77-6

2',4'-Dihydroxy-5'-nitroacetophenone

Purity: ≥95%

Molecular weight: 197.14g/mol

Ref: 54-OR345076