CAS 33284-45-6

1,1,1-Trifluoro-5-methyl-2,4-heptanedione

Description:

1,1,1-Trifluoro-5-methyl-2,4-heptanedione is a fluorinated organic compound characterized by the presence of three fluorine atoms and a diketone functional group. Its molecular structure features a heptane backbone with a methyl group and two carbonyl groups located at the 2 and 4 positions, contributing to its reactivity and potential applications in various chemical processes. The trifluoromethyl group enhances the compound's lipophilicity and stability, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents. Due to the presence of fluorine, it may exhibit unique properties such as increased volatility and altered reactivity compared to non-fluorinated analogs. Safety precautions should be taken when handling this substance, as it may pose health risks, including potential toxicity and environmental concerns associated with fluorinated compounds.

Formula: C₈H₁₁F₃O₂

InChI: InChI=1S/C8H11F3O2/c1-3-5(2)6(12)4-7(13)8(9,10)11/h5H,3-4H2,1-2H3

InChI key: InChIKey=XQIBVFWBYJDHQQ-UHFFFAOYSA-N

SMILES: C(C(C(CC)C)=O)C(C(F)(F)F)=O

Synonyms:

• 1,1,1-Trifluoro-5-methylheptane-2,4-dione
• Trifluoroacetyl-α-methylbutyrylmethane
• 1,1,1-Trifluoro-5-methyl-2,4-heptanedione
• 2,4-Heptanedione, 1,1,1-trifluoro-5-methyl-