CAS 3329-14-4
:Piperidine, 1-(3,3-diphenylpropyl)-, hydrochloride (1:1)
Description:
Piperidine, 1-(3,3-diphenylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a 3,3-diphenylpropyl substituent, contributing to its unique properties and potential applications. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for interactions with various biological targets, potentially influencing neurotransmitter systems. The presence of the diphenyl group may also impart lipophilicity, affecting its pharmacokinetics and bioavailability. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound represents a specific class of piperidine derivatives that may have applications in drug development and research.
Formula:C20H25N·ClH
InChI:InChI=1S/C20H25N.ClH/c1-4-10-18(11-5-1)20(19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21;/h1-2,4-7,10-13,20H,3,8-9,14-17H2;1H
InChI key:InChIKey=KNTZUVDGULKCPO-UHFFFAOYSA-N
SMILES:C(CCN1CCCCC1)(C2=CC=CC=C2)C3=CC=CC=C3.Cl
Synonyms:- 1-(3,3-Diphenylpropyl)piperidine hydrochloride
- Piperidine, 1-(3,3-diphenylpropyl)-, hydrochloride (1:1)
- N-(3,3-Diphenylpropyl)piperidine hydrochloride
- 1,1-Diphenyl-3-piperidinopropane hydrochloride
- Piperidine, 1-(3,3-diphenylpropyl)-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
