CAS 3329-30-4
:N-Methylglucosamine
Description:
N-Methylglucosamine, with the CAS number 3329-30-4, is an amino sugar derived from glucose. It is characterized by the presence of a methyl group attached to the nitrogen atom of the amino group, which distinguishes it from glucosamine. This compound is typically a white to off-white crystalline solid and is soluble in water due to its polar hydroxyl groups. N-Methylglucosamine plays a significant role in various biological processes, including the synthesis of glycosaminoglycans and glycoproteins, which are essential for cellular structure and function. It is also studied for its potential applications in pharmaceuticals, particularly in the context of joint health and anti-inflammatory effects. The compound exhibits a molecular formula that reflects its structure, containing carbon, hydrogen, nitrogen, and oxygen atoms. Its reactivity is influenced by the functional groups present, allowing it to participate in various chemical reactions, including those involved in carbohydrate metabolism. Overall, N-Methylglucosamine is an important compound in both biological and chemical research.
Formula:C7H15NO5
InChI:InChI=1S/C7H15NO5/c1-8-4(2-9)6(12)7(13)5(11)3-10/h2,4-8,10-13H,3H2,1H3/t4-,5+,6+,7+/m0/s1
InChI key:InChIKey=LDDMACCNBZAMSG-BDVNFPICSA-N
SMILES:[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)(C=O)NC
Synonyms:- N-Methylglucosamine
- 2-Deoxy-2-(methylamino)-D-glucose
- D-Glucosamine, N-methyl-
- D-Glucose, 2-deoxy-2-(methylamino)-
- N-Methyl-D-glucosamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-Methyl-D-glucosamine
CAS:<p>N-Methyl-D-glucosamine is a nucleotide that is found in the adenine nucleotide pool. It can be synthesized from glucose, which is converted to glucosamine-6-phosphate by the enzyme glucosamine synthetase. This compound can also be obtained from dietary sources. N-Methyl-D-glucosamine has been shown to have cytotoxic activity against mouse tumor cells and inhibit skin cancer in mice. It binds with DNA and inhibits cell growth through a glycosidic bond with terminal residues of DNA, preventing transcription and replication. N-Methyl-D-glucosamine has also been shown to inhibit the growth of resistant microorganisms such as C. glabrata, including antibiotic resistant strains, and bacteria such as E. coli and P. aeruginosa when used in combination with an experimental model of biocompatible polymers.<br>NMTG has been shown to</p>Formula:C7H15NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:193.2 g/mol
