CAS 33295-37-3

1-Bromo-8-methylnaphthalene

Description:

1-Bromo-8-methylnaphthalene is an organic compound characterized by the presence of a bromine atom and a methyl group attached to the naphthalene structure. It features a naphthalene backbone, which consists of two fused benzene rings, providing it with a planar, aromatic character that contributes to its stability and reactivity. The bromine substituent introduces a polar functional group, which can influence the compound's solubility and reactivity in various chemical reactions, such as nucleophilic substitutions. The methyl group at the 8-position affects the electronic distribution and steric hindrance, potentially impacting its reactivity and interactions with other molecules. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals, agrochemicals, or other complex organic compounds. Its physical properties, such as melting point, boiling point, and solubility, are influenced by the presence of the bromine and methyl groups, making it an interesting subject for study in both synthetic and applied chemistry contexts.

Formula: C₁₁H₉Br

InChI: InChI=1S/C11H9Br/c1-8-4-2-5-9-6-3-7-10(12)11(8)9/h2-7H,1H3

InChI key: InChIKey=QTWVRVGVJURUFK-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=CC=C2C)C=CC1

Synonyms:

• 1-Bromo-8-methylnaphthalene
• Naphthalene, 1-bromo-8-methyl-

1-bromo-8-methylnaphthalene

CAS: 33295-37-3

Formula: C₁₁H₉Br

Purity: 97%

Color and Shape: Solid

Molecular weight: 221.0932

Ref: IN-DA00CHAC

1-Bromo-8-methylnaphthalene

CAS: 33295-37-3

1-Bromo-8-methylnaphthalene

Purity: 97%

Molecular weight: 221.09g/mol

Ref: 54-OR91481

1-Bromo-8-methylnaphthalene

CAS: 33295-37-3

Purity: 97%

Molecular weight: 221.0970001

Ref: 10-F604597

1-Bromo-8-methylnaphthalene

CAS: 33295-37-3

1-Bromo-8-methylnaphthalene is a synthetic chemical that belongs to the group of butyric acid derivatives. It has been shown to react reversibly with alcohols and carbonyls, as well as iodides and cinnamic acids. 1-Bromo-8-methylnaphthalene can be synthesized from xylene using lithium diisopropylamide (LDA) in the presence of an amine base, yielding a mixture of products, including oxetane. This compound crystallizes in space group P2(1)/c with unit cell dimensions a = 12.7 Å, b = 14.4 Å, c = 18.5 Å, β = 98.1° and Z = 2.

Formula: C₁₁H₉Br

Purity: Min. 95%

Molecular weight: 221.1 g/mol

Ref: 3D-IBA29537