
CAS 333-29-9
:2-[Diethoxyphosphinothioylimino]-1,3-dithiolane
Description:
2-[Diethoxyphosphinothioylimino]-1,3-dithiolane, with CAS number 333-29-9, is a chemical compound characterized by its unique structure that includes a dithiolane ring and a phosphinothioyl group. This compound typically exhibits properties associated with both phosphorus and sulfur chemistry, making it a versatile intermediate in organic synthesis. It is often used in the preparation of various organophosphorus compounds and may exhibit biological activity, potentially serving as a precursor in agrochemical applications. The presence of the diethoxy groups enhances its solubility in organic solvents, while the dithiolane structure contributes to its stability and reactivity. Additionally, the compound may participate in nucleophilic substitution reactions due to the presence of the phosphinothioyl moiety, which can influence its reactivity profile. Overall, 2-[Diethoxyphosphinothioylimino]-1,3-dithiolane is notable for its potential applications in synthetic chemistry and its role in the development of phosphorus-containing compounds.
Formula:C7H14NO2PS3
InChI:InChI=1S/C7H14NO2PS3/c1-3-9-11(12,10-4-2)8-7-13-5-6-14-7/h3-6H2,1-2H3
InChI key:InChIKey=YWITZONHXPIYDK-UHFFFAOYSA-N
SMILES:N(P(OCC)(OCC)=S)=C1SCCS1
Synonyms:- AC 43064
- Imidocarbonic acid, (diethoxyphosphinothioyl)dithio-, cyclic ethylene ester
- Phosphoramidothioic acid, 1,3-dithiolan-2-ylidene-, O,O-diethyl ester
- Ent 25809
- American Cyanamid 43064
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
