CAS 333-47-1
:1-Bromo-4-(trifluoromethylthio)benzene
Description:
1-Bromo-4-(trifluoromethylthio)benzene is an organic compound characterized by the presence of a bromine atom and a trifluoromethylthio group attached to a benzene ring. Its molecular structure features a bromine substituent at the para position relative to the trifluoromethylthio group, which consists of a sulfur atom bonded to a trifluoromethyl group (–CF3). This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its relatively low solubility in water but is soluble in organic solvents such as acetone and dichloromethane. The presence of both bromine and trifluoromethyl groups contributes to its reactivity, making it useful in various chemical syntheses, particularly in the field of pharmaceuticals and agrochemicals. Additionally, the trifluoromethylthio group imparts unique electronic properties, enhancing the compound's potential applications in material science and as a building block in organic synthesis. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.
Formula:C7H4BrF3S
InChI:InChI=1/C7H4BrF3S/c8-5-1-3-6(4-2-5)12-7(9,10)11/h1-4H
SMILES:c1cc(ccc1Br)SC(F)(F)F
Synonyms:- 4-Bromophenyl trifluoromethyl sulphide
- 4-(Trifluoromethylthio)bromobenzene
- 1-Bromo-4-[(Trifluoromethyl)Sulfanyl]Benzene
- 1-Bromo-4-trifluoromethylthiobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-4-(trifluoromethylthio)benzene, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H4BrF3SPurity:97%Color and Shape:Liquid, Clear colorless to pale yellowMolecular weight:257.071-Bromo-4-trifluoromethylthiobenzene
CAS:Formula:C7H4BrF3SPurity:98%Color and Shape:LiquidMolecular weight:257.07094-Bromophenyl trifluoromethyl sulphide
CAS:4-Bromophenyl trifluoromethyl sulphideFormula:C7H4BrF3SPurity:97%Color and Shape: clear. colourless liquidMolecular weight:257.07g/mol4-(Trifluoromethylthio)bromobenzene
CAS:Formula:C7H4BrF3SPurity:98%Color and Shape:Liquid, ClearMolecular weight:257.07



