CAS 333-56-2
:ethyl 8-fluoro-3-oxooctanoate
Description:
Ethyl 8-fluoro-3-oxooctanoate, identified by its CAS number 333-56-2, is an organic compound that belongs to the class of esters. It features a fluoro substituent, which can influence its reactivity and physical properties. The presence of the keto group (3-oxo) indicates that it has a carbonyl functional group, contributing to its potential reactivity in various chemical reactions, such as nucleophilic additions. This compound is typically characterized by its moderate polarity due to the ester and carbonyl functionalities, which can affect its solubility in polar and non-polar solvents. Additionally, the fluoro group can enhance the compound's lipophilicity and may impart unique biological activities. Ethyl 8-fluoro-3-oxooctanoate is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological and chemical properties. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H17FO3
InChI:InChI=1/C10H17FO3/c1-2-14-10(13)8-9(12)6-4-3-5-7-11/h2-8H2,1H3
SMILES:CCOC(=O)CC(=O)CCCCCF
Synonyms:- Octanoic Acid, 8-Fluoro-3-Oxo-, Ethyl Ester
- Ethyl 8-fluoro-3-oxooctanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.