CAS 33317-65-6
:Dichlorobis(3-chloropropyl)silane
Description:
Dichlorobis(3-chloropropyl)silane is an organosilicon compound characterized by its silane structure, which features a silicon atom bonded to two chlorine atoms and two 3-chloropropyl groups. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in the presence of moisture, which can lead to hydrolysis and the formation of silanol groups. It is used in various applications, including as a coupling agent in the synthesis of silicone polymers and as a precursor in the production of silane-modified materials. The presence of chlorine atoms enhances its reactivity, making it useful in chemical synthesis and surface modification processes. Safety precautions are necessary when handling this substance, as it can be corrosive and may pose health risks upon exposure. Proper storage in a cool, dry place away from moisture is essential to maintain its stability and effectiveness.
Formula:C6H12Cl4Si
InChI:InChI=1S/C6H12Cl4Si/c7-3-1-5-11(9,10)6-2-4-8/h1-6H2
InChI key:InChIKey=HDNRFVFMQJSRPE-UHFFFAOYSA-N
SMILES:[Si](CCCCl)(CCCCl)(Cl)Cl
Synonyms:- Bis(3-chloropropyl)dichlorosilane
- Silane, dichlorobis(3-chloropropyl)-
- Dichlorobis(3-chloropropyl)silane
- Dichlorobis(3-chloropropyl)silane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.