CAS 333309-25-4

Methyl 5,6-dihydro-3-(trifluoromethyl)-1(4H)-cyclopentapyrazoleacetate

Description:

Methyl 5,6-dihydro-3-(trifluoromethyl)-1(4H)-cyclopentapyrazoleacetate, identified by its CAS number 333309-25-4, is a chemical compound characterized by its unique structural features, including a cyclopentapyrazole ring and a trifluoromethyl group. This compound typically exhibits properties associated with pyrazole derivatives, such as potential biological activity and reactivity due to the presence of the ester functional group. The trifluoromethyl group enhances lipophilicity and can influence the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the dihydro configuration suggests that it may participate in various chemical reactions, including nucleophilic substitutions or cycloadditions. Its synthesis and applications may be relevant in fields such as agrochemicals or pharmaceuticals, where such compounds are explored for their efficacy and safety profiles. As with many chemical substances, handling and usage should adhere to safety guidelines due to potential toxicity or environmental impact.

Formula: C₁₀H₁₁F₃N₂O₂

InChI: InChI=1S/C10H11F3N2O2/c1-17-8(16)5-15-7-4-2-3-6(7)9(14-15)10(11,12)13/h2-5H2,1H3

InChI key: InChIKey=VTEZFSZBHQUQON-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1C2=C(C(C(F)(F)F)=N1)CCC2

Synonyms:

• Methyl 5,6-dihydro-3-(trifluoromethyl)-1(4H)-cyclopentapyrazoleacetate
• 1(4H)-Cyclopentapyrazoleacetic acid, 5,6-dihydro-3-(trifluoromethyl)-, methyl ester

Methyl 2-[3-(trifluoromethyl)-1H,4H,5H,6H-cyclopenta[C]pyrazol-1-yl]acetate

CAS: 333309-25-4

Versatile small molecule scaffold

Formula: C₁₀H₁₁F₃N₂O₂

Purity: Min. 95%

Molecular weight: 248.2 g/mol

Ref: 3D-INA30925