CymitQuimica logo

CAS 333329-21-8

:

Ethyl 4-[[(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)carbonyl]amino]benzoate

Description:
Ethyl 4-[[[3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl]carbonyl]amino]benzoate, with CAS number 333329-21-8, is a chemical compound characterized by its complex structure, which includes a thieno[2,3-b]pyridine moiety and an ethyl ester functional group. This compound features a benzoate group that is substituted with an amino group, contributing to its potential biological activity. The presence of the thieno[2,3-b]pyridine structure suggests that it may exhibit interesting pharmacological properties, possibly related to its interactions with biological targets. The ethyl ester group enhances its solubility and may influence its absorption and distribution in biological systems. Additionally, the compound's synthesis typically involves multi-step organic reactions, highlighting its complexity. Its potential applications could span various fields, including medicinal chemistry and drug development, particularly in the search for novel therapeutic agents. As with many organic compounds, its stability, reactivity, and biological activity would depend on specific environmental conditions and the presence of other chemical entities.
Formula:C19H19N3O3S
InChI:InChI=1S/C19H19N3O3S/c1-4-25-19(24)12-5-7-13(8-6-12)22-17(23)16-15(20)14-10(2)9-11(3)21-18(14)26-16/h5-9H,4,20H2,1-3H3,(H,22,23)
InChI key:InChIKey=BAGOHFKBOZZCOQ-UHFFFAOYSA-N
SMILES:NC=1C=2C(SC1C(NC3=CC=C(C(OCC)=O)C=C3)=O)=NC(C)=CC2C
Synonyms:
  • Ethyl 4-[[(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)carbonyl]amino]benzoate
  • Benzoic acid, 4-[[(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)carbonyl]amino]-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.