CAS 33342-30-2: 5-(4-nitrophenyl)furfuryl alcohol
Description:5-(4-Nitrophenyl)furfuryl alcohol is an organic compound characterized by its unique structure, which includes a furfuryl alcohol moiety and a para-nitrophenyl group. This compound typically appears as a yellow to brown solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and interactions in chemical reactions. It may exhibit properties such as moderate to high stability under standard conditions, but can be sensitive to strong acids or bases. This compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of pharmaceuticals, agrochemicals, and polymeric materials. Additionally, its functional groups may allow for further derivatization, making it a versatile intermediate in synthetic chemistry. Safety precautions should be observed when handling this compound, as nitro compounds can pose health risks.
Formula:C11H9NO4
InChI:InChI=1/C11H9NO4/c13-7-10-5-6-11(16-10)8-1-3-9(4-2-8)12(14)15/h1-6,13H,7H2
- Synonyms:
- [5-(4-Nitrophenyl)Furan-2-Yl]Methanol
