CAS 333432-27-2: 4,7-dibromo-[1,2,5]thiadiazolo[3,4-c]pyridine

Description:4,7-Dibromo-[1,2,5]thiadiazolo[3,4-c]pyridine is a heterocyclic compound characterized by its unique structure, which includes a thiadiazole ring fused to a pyridine moiety. This compound features two bromine substituents at the 4 and 7 positions of the thiadiazole ring, which can significantly influence its chemical reactivity and physical properties. Typically, such compounds exhibit interesting electronic properties due to the presence of multiple heteroatoms, which can facilitate interactions with various biological targets or materials. The presence of bromine atoms may enhance the compound's lipophilicity and stability, making it suitable for applications in pharmaceuticals or agrochemicals. Additionally, the compound may exhibit fluorescence or other photophysical properties, depending on its environment and substituents. Its synthesis often involves multi-step reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. Overall, 4,7-dibromo-[1,2,5]thiadiazolo[3,4-c]pyridine represents a class of compounds with potential utility in various fields of research and industry.

Formula:C₅HBr₂N₃S

InChI:InChI=1S/C5HBr2N3S/c6-2-1-8-5(7)4-3(2)9-11-10-4/h1H

Synonyms:
[1,2,5]Thiadiazolo[3,4-c]pyridine, 4,7-dibroMo-
K0216

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4,7-Dibromo[1,2,5]thiadiazolo[3,4-c]pyridine REF: 3B-D4442CAS: 333432-27-2	>96.0%(GC)	69.00 €~214.00 €	Tue 29 Apr 25
4,7-Dibromo[1,2,5]thiadiazolo[3,4-c]pyridine REF: 54-OR938994CAS: 333432-27-2	98%	37.00 €~1,170.00 €	Mon 05 May 25
4,7-Dibromo-[1,2,5]thiadiazolo[3,4-c]pyridine REF: 10-F327530CAS: 333432-27-2	95.0%	To inquire	Wed 14 May 25
4,7-Dibromo[1,2,5]thiadiazolo[3,4-c]pyridine REF: 3D-INA43227CAS: 333432-27-2	Min. 95%	- - -	Discontinued product