CAS 33359-03-4
:4,6-dimethyl-1,4-dihydro-9H-imidazo[1,2-a]purin-9-one
Description:
4,6-Dimethyl-1,4-dihydro-9H-imidazo[1,2-a]purin-9-one, with the CAS number 33359-03-4, is a purine derivative characterized by its bicyclic structure, which includes an imidazole and a purine ring. This compound features two methyl groups at the 4 and 6 positions of the imidazole ring, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the carbonyl group at the 9 position enhances its reactivity and potential biological activity. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, including antiviral and anticancer properties. Its structural features allow for interactions with various biological targets, making it a subject of research in drug development. As with many purine derivatives, it may exhibit nucleoside-like behavior, influencing its role in biochemical processes. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H9N5O
InChI:InChI=1/C9H9N5O/c1-5-3-14-8(15)6-7(11-4-10-6)13(2)9(14)12-5/h3-4H,1-2H3,(H,10,11)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
