CAS 3336-16-1
:2-chloro-4-hydroxybenzonitrile
Description:
2-Chloro-4-hydroxybenzonitrile, with the CAS number 3336-16-1, is an organic compound that features a benzene ring substituted with a chlorine atom, a hydroxyl group, and a nitrile group. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the hydroxyl group (-OH) imparts polar characteristics, enhancing its solubility in polar solvents, while the nitrile group (-C≡N) introduces a strong electron-withdrawing effect, influencing its reactivity in various chemical reactions. The chlorine atom serves as a halogen substituent, which can affect the compound's physical properties, such as boiling and melting points. Typically, 2-chloro-4-hydroxybenzonitrile is utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific applications often depend on its reactivity and the functional groups present, making it a valuable compound in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H4ClNO
InChI:InChI=1/C7H4ClNO/c8-7-3-6(10)2-1-5(7)4-9/h1-3,10H
SMILES:c1cc(cc(c1C#N)Cl)O
Synonyms:- Benzonitrile, 2-Chloro-4-Hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-4-hydroxybenzonitrile
CAS:Formula:C7H4ClNOPurity:95%Color and Shape:SolidMolecular weight:153.56582-Chloro-4-hydroxybenzonitrile
CAS:2-Chloro-4-hydroxybenzonitrileFormula:C7H4ClNOPurity:98%Color and Shape: white powderMolecular weight:153.57g/mol2-Chloro-4-hydroxybenzonitrile
CAS:Formula:C7H4ClNOPurity:97.0%Color and Shape:SolidMolecular weight:153.572-Chloro-4-hydroxybenzonitrile
CAS:2-Chloro-4-hydroxybenzonitrile is a phenyl ring with a macrocyclization that has anisotropic properties. It is soluble in chloroform and benzene, but insoluble in ethers. This compound can be modified to form a macrocycle and is used as an antidiabetic drug. 2-Chloro-4-hydroxybenzonitrile has been synthesized using the crystal compound of cyclohexane, which has been modified to form a macrocyclic structure. The synthesis of this compound was optimized for increased stability and decreased toxicity by changing the substitution pattern on the phenyl ring. The synthesis was also done using liquid crystals, which resulted in an increase in optical activity due to its chiral structure.Formula:C7H4ClNOPurity:Min. 95%Color and Shape:PowderMolecular weight:153.57 g/mol



