CAS 3336-39-8
:3,5-Dibromo-4-methoxybenzonitrile
Description:
3,5-Dibromo-4-methoxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms and a methoxy group, as well as a cyano group. The presence of the bromine atoms enhances its reactivity and can influence its physical properties, such as solubility and boiling point. The methoxy group (-OCH3) is an electron-donating substituent that can affect the compound's electronic properties and reactivity in electrophilic aromatic substitution reactions. The cyano group (-CN) is a strong electron-withdrawing group, which can increase the acidity of nearby hydrogen atoms and influence the compound's overall reactivity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. As with many brominated compounds, it is important to handle it with care due to potential environmental and health impacts.
Formula:C8H5Br2NO
InChI:InChI=1S/C8H5Br2NO/c1-12-8-6(9)2-5(4-11)3-7(8)10/h2-3H,1H3
InChI key:InChIKey=BUGMOVRSBPGSOS-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)C=C(C#N)C=C1Br
Synonyms:- 4-Methoxy-3,5-dibromobenzonitrile
- Benzonitrile, 3,5-dibromo-4-methoxy-
- 3,5-Dibromo-4-methoxybenzonitrile
- p-Anisonitrile, 3,5-dibromo-
- Bromoxynil methyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
BROMOXYNIL-METHYL ETHER
CAS:Formula:C8H5Br2NOPurity:97%Color and Shape:SolidMolecular weight:290.9394Bromoxynil-methyl ether
CAS:Controlled ProductFormula:C8H5Br2NOColor and Shape:NeatMolecular weight:290.943,5-Dibromo-4-methoxybenzonitrile
CAS:3,5-Dibromo-4-methoxybenzonitrile (DBMB) is a pentane that can be synthesized in the laboratory. DBMB is used as a weed control agent to kill weeds and grasses in neoprene rubber products and other materials. The chemical reacts with nitro groups on the surface of the material, producing an unstable intermediate that decomposes into pentane and nitric acid. 3,5-Dibromo-4-methoxybenzonitrile has been shown to have low toxicity to mammals at high doses. The compound may also be used as a chemical intermediate for the synthesis of other compounds or drugs. Nitro groups may be reduced by reductants such as sodium borohydride or lithium aluminium hydride to produce analdehyde derivatives.Formula:C8H5Br2NOPurity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:290.94 g/mol




