CAS 3336-43-4

1-Chloro-4-isoquinolinol

Description:

1-Chloro-4-isoquinolinol is an organic compound characterized by its isoquinoline structure, which features a fused bicyclic system comprising a benzene ring and a pyridine ring. The presence of a chlorine atom at the 1-position and a hydroxyl group at the 4-position contributes to its unique chemical properties. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound may exhibit biological activity, making it of interest in research related to drug design and synthesis. Additionally, 1-Chloro-4-isoquinolinol's solubility and stability can vary depending on the solvent and environmental conditions, influencing its reactivity and potential uses in various chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₆ClNO

InChI: InChI=1S/C9H6ClNO/c10-9-7-4-2-1-3-6(7)8(12)5-11-9/h1-5,12H

InChI key: InChIKey=JEVLGPVFFYUBRI-UHFFFAOYSA-N

SMILES: OC=1C2=C(C(Cl)=NC1)C=CC=C2

Synonyms:

• 1-Chloro-4-isoquinolinol
• 1-Chloroisoquinolin-4-ol
• 4-Isoquinolinol, 1-chloro-
• 1-Chloro-4-hydroxyisoquinoline

1-Chloroisoquinolin-4-ol

CAS: 3336-43-4

Formula: C₉H₆ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 179.6030

Ref: IN-DA003E8N

1-Chloro-4-hydroxyisoquinoline

CAS: 3336-43-4

1-Chloro-4-hydroxyisoquinoline

Formula: C₉H₆ClNO

Purity: 95%

Color and Shape: pale pink solid

Molecular weight: 179.60g/mol

Ref: 54-OR61534

1-Chloroisoquinolin-4-ol

CAS: 3336-43-4

Formula: C₉H₆ClNO

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 179.6

Ref: 10-F067515

1-Chloroisoquinolin-4-ol

CAS: 3336-43-4

1-Chloroisoquinolin-4-ol is a phenylpyrimidine with anti-inflammatory properties. It is used in the treatment of sensitivity and mediated diseases, such as osteoarthritis, rheumatoid arthritis, and ankylosing spondylitis. 1-Chloroisoquinolin-4-ol inhibits the enzymatic activity of matrix metalloproteinases (MMPs), which are enzymes that break down collagen and other proteins in the body. The inhibition of MMPs by 1-chloroisoquinolin-4-ol leads to reduced inflammation and pain. This compound is also an effective inhibitor of the activities of chloride channels involved in acid secretion by cells in the stomach lining, thus inhibiting acid production. 1-Chloroisoquinolin-4-ol has been shown to have anticholesterolemic effects on liver cells due to its ability to inhibit cholesterol synthesis through inhibition of HMG CoA

Formula: C₉H₆ClNO

Purity: Min. 95%

Molecular weight: 179.6 g/mol

Ref: 3D-DAA33643