CAS 333786-74-6

3-{[4-methyl-5-(pyridin-3-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}propanoic acid

Description:

3-{[4-methyl-5-(pyridin-3-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}propanoic acid is a chemical compound characterized by its unique structure, which includes a propanoic acid moiety linked to a triazole ring that contains a pyridine substituent. The presence of the sulfanyl group introduces a thiol functionality, which can enhance the compound's reactivity and potential biological activity. This compound is likely to exhibit properties typical of both triazoles and carboxylic acids, such as the ability to form hydrogen bonds and participate in various chemical reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heterocyclic rings that are often associated with bioactive compounds. Additionally, the methyl and pyridine groups may influence its solubility, stability, and interaction with biological targets. Overall, this compound represents a complex organic molecule with potential significance in various chemical and biological contexts.

Formula: C₁₁H₁₂N₄O₂S

InChI: InChI=1/C11H12N4O2S/c1-15-10(8-3-2-5-12-7-8)13-14-11(15)18-6-4-9(16)17/h2-3,5,7H,4,6H2,1H3,(H,16,17)

SMILES: Cn1c(c2cccnc2)nnc1SCCC(=O)O

Synonyms:

• propanoic acid, 3-[[4-methyl-5-(3-pyridinyl)-4H-1,2,4-triazol-3-yl]thio]-

3-{[4-methyl-5-(3-pyridinyl)-4H-1,2,4-triazol-3-yl]thio}propanoic acid

CAS: 333786-74-6

Formula: C₁₁H₁₂N₄O₂S

Purity: 95.0%

Molecular weight: 264.3

Ref: 10-F315629