CAS 33390-42-0: Gartanin
Description:Gartanin, with the CAS number 33390-42-0, is a naturally occurring compound classified as a flavonoid, specifically a type of flavanone. It is primarily derived from the plant species Garcinia mangostana, commonly known as mangosteen. Gartanin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The compound is characterized by its polyphenolic structure, which contributes to its ability to scavenge free radicals and modulate various biochemical pathways. Additionally, gartanin has been studied for its effects on metabolic processes and its potential role in promoting overall health. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in dietary supplements and functional foods. As research continues, gartanin may reveal further therapeutic potentials, highlighting the importance of natural compounds in modern medicine.
Formula:C23H24O6
InChI:InChI=1/C23H24O6/c1-11(2)5-7-13-19(26)14(8-6-12(3)4)22-18(20(13)27)21(28)17-15(24)9-10-16(25)23(17)29-22/h5-6,9-10,24-27H,7-8H2,1-4H3
InChI key:InChIKey=OJXQLGQIDIPMTE-UHFFFAOYSA-N
SMILES:O=C1C=2C(O)=CC=C(O)C2OC3=C1C(O)=C(C(O)=C3CC=C(C)C)CC=C(C)C
- Synonyms:
- 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-buten-1-yl)-9H-xanthen-9-one
- 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one
- 1,3,5,8-Tetrahydroxy-2,4-bis(3-methylbut-2-enyl)xanthen-9-one
- 1,3,5,8-tetrahydroxy-2,4-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one
- 9H-Xanthen-9-one, 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-buten-1-yl)-
- 9H-Xanthen-9-one, 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-
- NSC 692946
- Xanthen-9-one, 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-
- Gartanin
- Aids-098106
- See more synonyms
- 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)xanthone
- Aids098106
- Gartanin, 98%, from Garcinia mangostana L.
