
CAS 33396-37-1
:(3β)-3-[(6-Deoxy-4-O-methyl-α-L-mannopyranosyl)oxy]-14-hydroxybufa-4,20,22-trienolide
Description:
The chemical substance known as (3β)-3-[(6-Deoxy-4-O-methyl-α-L-mannopyranosyl)oxy]-14-hydroxybufa-4,20,22-trienolide, with the CAS number 33396-37-1, is a complex natural product derived from the bufadienolide class of compounds. This substance features a steroidal backbone, characterized by a specific arrangement of hydroxyl groups and a sugar moiety, which contributes to its biological activity. The presence of the 6-deoxy-4-O-methyl-α-L-mannopyranosyl group indicates that it is glycosylated, enhancing its solubility and potentially influencing its pharmacokinetics and bioactivity. The compound exhibits structural features typical of bufadienolides, including multiple double bonds and hydroxyl groups, which are often associated with various biological effects, including cytotoxicity and potential therapeutic applications. Its unique structure may also confer specific interactions with biological targets, making it of interest in medicinal chemistry and pharmacology. Further studies are necessary to fully elucidate its mechanisms of action and potential therapeutic uses.
Formula:C31H44O8
InChI:InChI=1S/C31H44O8/c1-17-27(36-4)25(33)26(34)28(38-17)39-20-9-12-29(2)19(15-20)6-7-23-22(29)10-13-30(3)21(11-14-31(23,30)35)18-5-8-24(32)37-16-18/h5,8,15-17,20-23,25-28,33-35H,6-7,9-14H2,1-4H3/t17-,20-,21+,22-,23+,25-,26+,27-,28-,29-,30+,31-/m0/s1
InChI key:InChIKey=RKWPZPDLTYBKCL-RVZGXXANSA-N
SMILES:O[C@@]12[C@]3([C@@]([C@]4(C)C(CC3)=C[C@@H](O[C@H]5[C@H](O)[C@H](O)[C@@H](OC)[C@H](C)O5)CC4)(CC[C@]1(C)[C@H](CC2)C=6C=CC(=O)OC6)[H])[H]
Synonyms:- Proscillaridin 4-methyl ether
- (3β)-3-[(6-Deoxy-4-O-methyl-α-L-mannopyranosyl)oxy]-14-hydroxybufa-4,20,22-trienolide
- Bufa-4,20,22-trienolide, 3-[(6-deoxy-4-O-methyl-α-L-mannopyranosyl)oxy]-14-hydroxy-, (3β)-
- Bufa-4,20,22-trienolide, 3β-[(6-deoxy-4-O-methyl-α-L-mannopyranosyl)oxy]-14-hydroxy-
- Methyl proscillaridin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Meproscillarin
CAS:Meproscillarin is a glycoside with high bioavailability (about 70%) and an elimination independent of renal function.Formula:C31H44O8Color and Shape:SolidMolecular weight:544.68
