CAS 33398-79-7
:N'-methylhydrazinecarboximidamide
Description:
N'-Methylhydrazinecarboximidamide, identified by its CAS number 33398-79-7, is a chemical compound that features a hydrazine functional group, which is characterized by the presence of two nitrogen atoms connected by a single bond. This compound is typically recognized for its potential applications in various fields, including pharmaceuticals and agrochemicals. It possesses a carboximidamide functional group, which contributes to its reactivity and ability to form hydrogen bonds, influencing its solubility and interaction with other molecules. The methyl group attached to the nitrogen atom enhances its stability and may affect its biological activity. As with many hydrazine derivatives, N'-methylhydrazinecarboximidamide may exhibit properties such as being a potential reducing agent or a precursor in synthetic pathways. However, due to the presence of nitrogen-nitrogen bonds, it may also pose certain hazards, including toxicity and potential for explosive decomposition under specific conditions. Proper handling and safety measures are essential when working with this compound in laboratory or industrial settings.
Formula:C2H8N4
InChI:InChI=1/C2H8N4/c1-5-2(3)6-4/h4H2,1H3,(H3,3,5,6)
SMILES:CNC(=N)NN
Synonyms:- hydrazinecarboximidamide, N-methyl-
- N-Methylhydrazinecarboximidamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Methylhydrazinecarboximidamide hydroiodide
CAS:Formula:C2H9IN4Purity:97%Color and Shape:SolidMolecular weight:216.02411-Amino-3-methylguanidine hydroiodide
CAS:1-Amino-3-methylguanidine hydroiodideFormula:C2H8N4·HIPurity:95%Color and Shape: off-white crystalsMolecular weight:216.02g/molRef: 10-F952751
1g223.00€5g818.00€10g1,526.00€25g3,813.00€100g15,247.00€2.5g497.00€100mg87.00€250mg110.00€500mg150.00€1-Methyl-3-aminoguanidine Hydriodide
CAS:Controlled ProductApplications 1-Methyl-3-aminoguanidine Hydriodide is a useful reactant for preparing heterocyclic aldehydes.
References Foye, W. O., et al.: J. Pharma. Sci., 79, 527 (1990)Formula:C2H8N4•HIColor and Shape:NeatMolecular weight:216.021-Amino-3-methylguanidine hydroiodide
CAS:Versatile small molecule scaffoldFormula:C2H8N4·HIPurity:Min. 95%Molecular weight:216.02 g/mol




