CAS 333992-77-1

1-(Pyridin-3-ylmethyl)piperazine trihydrochloride

Description:

1-(Pyridin-3-ylmethyl)piperazine trihydrochloride is a chemical compound characterized by its piperazine core, which is substituted with a pyridin-3-ylmethyl group. This structure imparts specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of compounds targeting various neurological and psychiatric conditions. The trihydrochloride form indicates that the compound is a salt, which enhances its solubility in water, making it suitable for biological applications. The presence of multiple hydrochloride groups suggests that the compound may exhibit strong ionic interactions, influencing its stability and bioavailability. Additionally, the piperazine moiety is known for its ability to interact with neurotransmitter receptors, which may contribute to its potential therapeutic effects. Overall, this compound's unique structural features and properties make it a valuable subject of study in drug development and pharmacology.

Formula: C₁₀H₁₈Cl₃N₃

InChI: InChI=1/C10H15N3.3ClH/c1-2-10(8-12-3-1)9-13-6-4-11-5-7-13;;;/h1-3,8,11H,4-7,9H2;3*1H

SMILES: c1cc(cnc1)CN1CCNCC1.Cl.Cl.Cl

1-(Pyridin-3-ylmethyl)piperazine trihydrochloride

CAS: 333992-77-1

Formula: C₁₀H₁₈Cl₃N₃

Purity: 95.0%

Molecular weight: 286.63

Ref: 10-F512011

1-(Pyridin-3-ylmethyl)piperazinetrihydrochloride

Controlled Product

CAS: 333992-77-1

Please enquire for more information about 1-(Pyridin-3-ylmethyl)piperazinetrihydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₁₈Cl₃N₃

Purity: Min. 95%

Molecular weight: 286.63 g/mol

Ref: 3D-FP150218