CAS 33403-37-1

2,4,7-trichloro-3,8-dihydroxy-1,9-dimethyl-6-(1-methylprop-1-en-1-yl)-11H-dibenzo[b,e][1,4]dioxepin-11-one

Description:

2,4,7-Trichloro-3,8-dihydroxy-1,9-dimethyl-6-(1-methylprop-1-en-1-yl)-11H-dibenzo[b,e][1,4]dioxepin-11-one, with CAS number 33403-37-1, is a complex organic compound characterized by its multi-ring structure and the presence of multiple functional groups. This compound features a dibenzo[dioxepin] core, which contributes to its stability and potential biological activity. The presence of chlorine atoms indicates that it may exhibit unique reactivity and interactions in chemical processes. Hydroxy groups suggest potential for hydrogen bonding, influencing solubility and reactivity. The dimethyl and alkenyl substituents may enhance its lipophilicity, affecting its distribution in biological systems. Such structural characteristics often correlate with specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies are necessary to fully understand its behavior, including its synthesis, stability, and potential applications in various fields, such as pharmaceuticals or agrochemicals. As with many complex organic compounds, safety and environmental impact assessments are crucial for its practical use.

Formula: C₁₉H₁₅Cl₃O₅

InChI: InChI=1/C19H15Cl3O5/c1-5-6(2)9-12(21)14(23)8(4)16-18(9)26-17-10(19(25)27-16)7(3)11(20)15(24)13(17)22/h5,23-24H,1-4H3

SMILES: CC=C(C)c1c(c(c(C)c2c1Oc1c(c(C)c(c(c1Cl)O)Cl)C(=O)O2)O)Cl

Synonyms:

• 33403-37-1
• Nornidulin
• Ustin

Nornidulin

CAS: 33403-37-1

Nornidulin, a depsidone from A. nidulans, fights various bacteria, fungi, MRSA (MIC=2 μg/ml), and has larvicidal (LC50=1.7 μg/ml) and cytotoxic properties.

Formula: C₁₉H₁₅Cl₃O₅

Color and Shape: Solid

Molecular weight: 429.67

Ref: TM-T36541

Nornidulin

CAS: 33403-37-1

Formula: C₁₉H₁₅Cl₃O₅

Purity: ≥ 99.0%

Color and Shape: White to off-white powder

Molecular weight: 429.7

Ref: 7W-GA7366