CAS 3342-67-4: Chlorotripentyltin

Description:Chlorotripentyltin, with the CAS number 3342-67-4, is an organotin compound characterized by the presence of a tin atom bonded to three pentyl groups and one chlorine atom. This compound typically appears as a colorless to pale yellow liquid and is known for its applications in various fields, including as a biocide and in the formulation of antifouling paints. Chlorotripentyltin exhibits hydrophobic properties due to its long hydrocarbon chains, which contribute to its effectiveness in repelling water and preventing the growth of marine organisms on submerged surfaces. The compound is also recognized for its potential toxicity, particularly to aquatic life, which raises environmental concerns regarding its use and disposal. In terms of chemical stability, chlorotripentyltin can undergo hydrolysis in the presence of moisture, leading to the formation of tin oxides and other byproducts. Proper handling and safety measures are essential when working with this substance due to its hazardous nature.

Formula:C₁₅H₃₃ClSn

InChI:InChI=1S/3C5H11.ClH.Sn/c3*1-3-5-4-2;;/h3*1,3-5H2,2H3;1H;/q;;;;+1/p-1

InChI key:InChIKey=LKGICXFRDGZQHA-UHFFFAOYSA-M

SMILES:Cl[Sn](CCCCC)(CCCCC)CCCCC