CAS 3342-98-1
:1,2-Dihydro-3-methylbenz[j]aceanthrylen-1-ol
Description:
1,2-Dihydro-3-methylbenz[j]aceanthrylen-1-ol, with the CAS number 3342-98-1, is a polycyclic aromatic compound characterized by its complex fused ring structure, which includes multiple aromatic systems. This compound features a hydroxyl (-OH) group, contributing to its potential reactivity and solubility properties. The presence of the methyl group at the 3-position of the benzene ring influences its physical and chemical properties, such as melting point and boiling point. Typically, compounds of this nature exhibit hydrophobic characteristics due to their extensive aromatic systems, which can affect their interactions in biological systems and environmental contexts. Additionally, the compound may display fluorescence, making it of interest in various applications, including organic electronics and materials science. Its synthesis and reactivity can be influenced by the specific arrangement of its functional groups, which may also play a role in its biological activity and potential applications in pharmaceuticals or as a dye. As with many polycyclic aromatic compounds, caution is advised due to potential toxicity and environmental persistence.
Formula:C21H16O
InChI:InChI=1S/C21H16O/c1-12-6-7-14-10-18-15-5-3-2-4-13(15)8-9-16(18)21-19(22)11-17(12)20(14)21/h2-10,19,22H,11H2,1H3
InChI key:InChIKey=CHNZFZQGTXDBFI-UHFFFAOYSA-N
SMILES:OC1C2=C3C(=CC=4C2=CC=C5C4C=CC=C5)C=CC(C)=C3C1
Synonyms:- 1,2-Dihydro-3-methylbenz[j]aceanthrylen-1-ol
- 1-Cholanthrenol, 3-methyl-
- 1-Hydroxy-3-methylcholanthrene
- 3-Methylcholanthren-1-ol
- Benz[J]Aceanthrylen-1-Ol, 1,2-Dihydro-3-Methyl-
- 3-Methyl-1,2-dihydrocyclopenta[ij]tetraphen-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Hydroxy-3-methylcholanthrene
CAS:Controlled ProductFormula:C21H16OColor and Shape:NeatMolecular weight:284.351
