CAS 3343-53-1
:3-Deoxypentosone
Description:
3-Deoxypentosone, with the CAS number 3343-53-1, is a chemical compound that belongs to the class of sugars and sugar derivatives. It is characterized by its five-carbon backbone, which is typical of pentoses, and features a ketone functional group at the third carbon position. This compound is notable for its role in various biochemical pathways, particularly in the context of carbohydrate metabolism. It can participate in reactions typical of ketoses, such as isomerization and condensation, and may serve as an intermediate in the synthesis of more complex carbohydrates or related compounds. The presence of the ketone group imparts specific reactivity, allowing it to undergo various chemical transformations. Additionally, 3-deoxypentosone may exhibit specific optical activity due to its chiral centers, influencing its interactions in biological systems. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it an interesting subject of study in both organic chemistry and biochemistry.
Formula:C5H10O4
InChI:InChI=1S/C5H10O4/c6-2-4(8)1-5(9)3-7/h4,6-8H,1-3H2
InChI key:InChIKey=KKLZOXZZESQNKR-UHFFFAOYSA-N
SMILES:C(C(CO)O)C(CO)=O
Synonyms:- 1,4,5-Trihydroxy-2-pentanone
- 2-Pentanone, 1,4,5-trihydroxy-
- 3-Deoxypentosone
- 3-Deoxypentosulose
- 3-Deoxypentulose
- 3-Deoxyxylosone
- Pentulose, 3-deoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Deoxypentulose
CAS:3-Deoxypentulose is a kinetic, reactive and chromatographic compound that belongs to the family of glycolysis. It is present in small amounts in the blood and is derived from pentose sugars. The reaction mechanism of 3-deoxypentulose can be divided into two steps: glyoxal formation and hydroxide solution modification. In the first step, 3-deoxypentulose reacts with glucose to form glyoxal. In the second step, 3-deoxypentulose reacts with hydroxide solution to form galactose, which can further react with other compounds or be modified by enzymatic reactions. This compound has been used as a tagatose substitute in food products and as an oligosaccharide modifier. Recently, it has been shown that 3-deoxypentulose may be used as a chemical probe for studying glycolic acid synthesis in bacteria.Formula:C5H10O4Purity:Min. 95%Color and Shape:PowderMolecular weight:134.13 g/mol

