CAS 33431-40-2

1(3H)-Isobenzofuranone, 5,7-dihydroxy-4-methyl-6-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-

Description:

1(3H)-Isobenzofuranone, 5,7-dihydroxy-4-methyl-6-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, commonly referred to by its CAS number 33431-40-2, is a complex organic compound characterized by its unique structural features. This molecule contains a fused isobenzofuranone ring system, which contributes to its aromatic properties and potential biological activity. The presence of multiple hydroxyl groups (5,7-dihydroxy) indicates that it may exhibit significant polar characteristics, enhancing its solubility in polar solvents. The 4-methyl group and the long hydrophobic tail (3,7,11-trimethyl-2,6,10-dodecatrienyl) suggest that the compound may possess both hydrophilic and lipophilic properties, potentially influencing its interaction with biological membranes. The (E,E)- configuration denotes specific geometric isomerism, which can affect the compound's reactivity and biological activity. Overall, this compound may be of interest in fields such as medicinal chemistry and natural product research due to its structural complexity and potential pharmacological properties.

Formula: C₂₄H₃₂O₄

InChI: InChI=1S/C24H32O4/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-19-22(25)18(5)20-14-28-24(27)21(20)23(19)26/h8,10,12,25-26H,6-7,9,11,13-14H2,1-5H3/b16-10+,17-12+

InChI key: InChIKey=HKULYCOWDDIJCV-JTCWOHKRSA-N

SMILES: OC1=C2C(=C(C)C(O)=C1C/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)COC2=O

Synonyms:

• 1(3H)-Isobenzofuranone, 5,7-dihydroxy-4-methyl-6-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-
• Phthalide, 5,7-dihydroxy-4-methyl-6-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-
• 6-Farnesyl-5,7-dihydroxy-4-methyl phthalide

Mycophenolic Acid Impurity 15

CAS: 33431-40-2

Formula: C₂₄H₃₂O₄

Molecular weight: 384.52

Ref: 4Z-M-1653