CAS 334477-59-7

2-(4-fluoro-2-methylphenyl)piperazine dihydrochloride

Description:

2-(4-Fluoro-2-methylphenyl)piperazine dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 4-fluoro-2-methylphenyl group indicates that a fluorine atom and a methyl group are substituted on a phenyl ring, contributing to the compound's unique properties. This substance is typically encountered as a dihydrochloride salt, which enhances its solubility in water and may influence its pharmacological activity. The compound is of interest in medicinal chemistry, particularly for its potential applications in neuropharmacology, as piperazine derivatives are known to interact with various neurotransmitter systems. Its molecular structure suggests it may exhibit properties such as moderate lipophilicity, which can affect its bioavailability and distribution in biological systems. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₁₁H₁₇Cl₂FN₂

InChI: InChI=1/C11H15FN2.2ClH/c1-8-6-9(12)2-3-10(8)11-7-13-4-5-14-11;;/h2-3,6,11,13-14H,4-5,7H2,1H3;2*1H

SMILES: Cc1cc(ccc1C1CNCCN1)F.Cl.Cl

(S)-2-(4-Fluoro-2-methylphenyl)piperazine dihydrochloride

CAS: 334477-59-7

Formula: C₁₁H₁₇Cl₂FN₂

Purity: 95.0%

Molecular weight: 267.17

Ref: 10-F463809