CAS 3345-29-7
:1,1,2,2,9,9,10,10-Octafluoro[2.2]paracyclophane
Description:
1,1,2,2,9,9,10,10-Octafluoro[2.2]paracyclophane is a fluorinated organic compound characterized by its unique structure, which consists of a paracyclophane framework with eight fluorine atoms substituting hydrogen atoms. This compound exhibits notable thermal and chemical stability due to the presence of fluorine, which enhances its resistance to degradation and reactivity. The octafluorination contributes to its low surface energy and hydrophobic properties, making it useful in various applications, including coatings and materials science. Additionally, its rigid structure and symmetrical arrangement can influence its electronic properties, potentially making it of interest in the field of organic electronics. The compound is typically colorless and may be solid at room temperature, depending on its specific formulation and purity. Safety considerations should be taken into account when handling this substance, as fluorinated compounds can pose environmental and health risks. Overall, 1,1,2,2,9,9,10,10-Octafluoro[2.2]paracyclophane represents a fascinating example of how fluorination can modify the properties of organic molecules.
Formula:C16H8F8
InChI:InChI=1/C16H8F8/c17-13(18)9-1-2-10(4-3-9)14(19,20)16(23,24)12-7-5-11(6-8-12)15(13,21)22/h1-8H
SMILES:c1cc2ccc1C(C(c1ccc(cc1)C(C2(F)F)(F)F)(F)F)(F)F
Synonyms:- 2,2,3,3,8,8,9,9-Octafluorotricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene
- 2,2,3,3,8,8,9,9-Octafluorotricyclo[8.2.2.2~4,7~]Hexadeca-1(12),4,6,10,13,15-Hexaene
- Parylene HT
- 1,1,2,2,9,9,10,10-Octafluoro[2,2]paracyclophane
- parylene AF4(parylene HT)
- Parylene-AF4
- Parylene AF 4
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,2,3,3,8,8,9,9-Octafluorotricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene
CAS:Formula:C16H8F8Purity:98%Molecular weight:352.22191,1,2,2,9,9,10,10-Octafluoro[2.2]paracyclophane
CAS:1,1,2,2,9,9,10,10-Octafluoro[2.2]paracyclophane
Molecular weight:352.22195g/mol1,1,2,2,9,9,10,10-Octafluoro[2.2]paracyclophane
CAS:1,1,2,2,9,9,10,10-Octafluoro[2.2]paracyclophane is a synthetic chemical compound that can be used in cross-coupling reactions. It is an isomer of the more common 1-fluorocyclopropane and has been shown to have a shorter reaction time than 1-fluorocyclopropane. The compound's spectroscopic properties are similar to those of 1-fluorocyclopropane. The compound was synthesized by reacting nitrobenzene with cyclopentadiene in the presence of boronic acids and aluminum chloride. The mass spectrum of this compound shows peaks corresponding to the molecular ion at m/e=256 and its fragmentation pattern corresponds to a monosubstituted aromatic hydrocarbon.
Formula:C16H8F8Purity:Min. 98.5%Color and Shape:White Clear LiquidMolecular weight:352.22 g/mol



