CAS 33459-28-8

7-(2-Hydroxyethoxy)xanthone-2-carboxylic acid

Description:

7-(2-Hydroxyethoxy)xanthone-2-carboxylic acid, with the CAS number 33459-28-8, is a chemical compound belonging to the xanthone family, which is characterized by a tricyclic structure containing a fused benzopyranone moiety. This compound features a hydroxyl group and an ethoxy group, contributing to its solubility and reactivity. It is known for its potential biological activities, including antioxidant properties, which may be attributed to the presence of the hydroxyl groups that can donate electrons and neutralize free radicals. The carboxylic acid functional group enhances its polarity, making it more soluble in polar solvents. This compound may also exhibit fluorescence, making it useful in various applications, including as a fluorescent probe in biochemical assays. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents. However, specific biological activities and applications would require further investigation through empirical studies.

Formula: C₁₆H₁₂O₆

InChI: InChI=1/C16H12O6/c17-5-6-21-10-2-4-14-12(8-10)15(18)11-7-9(16(19)20)1-3-13(11)22-14/h1-4,7-8,17H,5-6H2,(H,19,20)

Synonyms:

• AH-7725
• 7-(2-hydroxyethoxy)-9-oxo-9H-xanthene-2-carboxylic acid

AH 7725

CAS: 33459-28-8

AH 7725 is an inhibitor of the asthma attack.

Formula: C₁₆H₁₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 300.26

Ref: TM-T23671