CAS 3346-61-0
:6-amino-1,3-dimethyl-5-nitropyrimidine-2,4(1H,3H)-dione
Description:
6-Amino-1,3-dimethyl-5-nitropyrimidine-2,4(1H,3H)-dione, with the CAS number 3346-61-0, is a heterocyclic organic compound belonging to the pyrimidine family. This compound features a pyrimidine ring substituted with amino, methyl, and nitro groups, which contribute to its chemical reactivity and potential biological activity. The presence of the amino group indicates that it can participate in hydrogen bonding, while the nitro group can undergo reduction reactions, making it a candidate for various chemical transformations. The dimethyl substitutions enhance its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest it could be involved in interactions with biological targets, although specific applications would depend on further research. Overall, 6-amino-1,3-dimethyl-5-nitropyrimidine-2,4(1H,3H)-dione is a versatile compound with potential implications in both synthetic and medicinal chemistry.
Formula:C6H8N4O4
InChI:InChI=1/C6H8N4O4/c1-8-4(7)3(10(13)14)5(11)9(2)6(8)12/h7H2,1-2H3
SMILES:Cn1c(c(c(=O)n(C)c1=O)N(=O)=O)N
Synonyms:- 2,4(1H,3H)-pyrimidinedione, 6-amino-1,3-dimethyl-5-nitro-
- 6-Amino-1,3-dimethyl-5-nitropyrimidine-2,4(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Amino-1,3-dimethyl-5-nitrosouracil
CAS:Controlled ProductApplications 6-Amino-1,3-dimethyl-5-nitrosouracil (cas# 3346-61-0) is a compound useful in organic synthesis.
References Varma, R., et al.: J. Ocular Pharmacol. Ther., 16, 571 (2000),Formula:C6H8N4O3Color and Shape:NeatMolecular weight:184.15

