CAS 334658-75-2
:(10-Phenylanthracen-9-yl)boronic acid
Description:
(10-Phenylanthracen-9-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenylanthracene moiety. This compound typically exhibits properties associated with both boronic acids and polycyclic aromatic hydrocarbons. It is likely to be a solid at room temperature, with potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics due to its conjugated structure, which can facilitate charge transport. The boronic acid group allows for reversible covalent bonding with diols, making it useful in various chemical reactions, including Suzuki coupling, which is significant in the synthesis of complex organic molecules. Additionally, the compound may exhibit fluorescence, a property that can be exploited in sensing applications. Its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, (10-Phenylanthracen-9-yl)boronic acid represents a versatile building block in organic synthesis and materials science.
Formula:C20H15BO2
InChI:InChI=1/C20H15BO2/c22-21(23)20-17-12-6-4-10-15(17)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)20/h1-13,22-23H
SMILES:c1ccc(cc1)c1c2ccccc2c(c2ccccc12)B(O)O
Synonyms:- Boronic acid,B-(10-phenyl-9-anthracenyl)-
- 10-Phenylantrhacen-9-Yl Boronic Acid
- 9-Phenylanthracen-10-Yl-10-Boronic Acid
- 10-Phenyl-9-anthracene boronic acid
- 10-Phenyl-9-anthraceneboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
10-Phenyl-9-anthraceneboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C20H15BO2Purity:min. 98.0 area%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:298.1510-Phenylanthracene-9-boronic acid, 98%
CAS:<p>It is used as pharmaceutical intermediate and as OLED materials. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referenc</p>Formula:C20H15BO2Purity:98%Molecular weight:298.1510-Phenylantrhacen-9-yl boronic acid
CAS:Formula:C20H15BO2Purity:97%Color and Shape:SolidMolecular weight:298.1429Ref: IN-DA003BEU
1g26.00€5g46.00€10g70.00€25g120.00€5kgTo inquire100g257.00€500gTo inquire250mg26.00€10-Phenylanthracene-9-boronic acid
CAS:10-Phenylanthracene-9-boronic acidFormula:C20H15BO2Purity:98%Color and Shape: white to off-white solidMolecular weight:298.14g/mol(10-Phenylanthracen-9-yl)boronic acid
CAS:Formula:C20H15BO2Purity:97%Color and Shape:ClearMolecular weight:298.15




