CAS 33469-47-5
:3,5-Dichlorobenzenesulfonic acid
Description:
3,5-Dichlorobenzenesulfonic acid is an aromatic sulfonic acid characterized by the presence of two chlorine atoms at the 3 and 5 positions of the benzene ring, along with a sulfonic acid group (-SO3H) attached to the aromatic system. This compound is typically a white to light yellow solid and is soluble in water, which is a common trait for sulfonic acids due to their polar sulfonate group. It exhibits strong acidity, making it useful in various chemical reactions, particularly in the synthesis of dyes, pharmaceuticals, and other organic compounds. The presence of chlorine atoms enhances its reactivity and can influence the electronic properties of the molecule, making it a valuable intermediate in organic synthesis. Additionally, 3,5-Dichlorobenzenesulfonic acid may have applications in the production of surfactants and as a reagent in analytical chemistry. Safety precautions should be taken when handling this compound, as it can be corrosive and may pose environmental hazards.
Formula:C6H4Cl2O3S
InChI:InChI=1S/C6H4Cl2O3S/c7-4-1-5(8)3-6(2-4)12(9,10)11/h1-3H,(H,9,10,11)
InChI key:InChIKey=IJJUDUDQGIIQOO-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC(Cl)=CC(Cl)=C1
Synonyms:- 3,5-Dichlorobenzenesulfonic acid
- Benzenesulfonic acid, 3,5-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
