CAS 3347-50-0
:2-(2,3-dimethylphenoxy)butanoic acid
Description:
2-(2,3-Dimethylphenoxy)butanoic acid, with the CAS number 3347-50-0, is an organic compound that belongs to the class of carboxylic acids. It features a butanoic acid backbone, which is a four-carbon chain terminating in a carboxylic acid functional group (-COOH). The compound is characterized by the presence of a 2,3-dimethylphenoxy group, indicating that a phenolic ring substituted with two methyl groups is attached to the butanoic acid via an ether linkage. This structure contributes to its unique chemical properties, including its solubility in organic solvents and potential reactivity in various chemical reactions. The presence of the carboxylic acid group allows for acidic behavior, making it capable of participating in acid-base reactions. Additionally, the compound may exhibit biological activity, which could be of interest in agricultural or pharmaceutical applications. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.
Formula:C12H16O3
InChI:InChI=1/C12H16O3/c1-4-10(12(13)14)15-11-7-5-6-8(2)9(11)3/h5-7,10H,4H2,1-3H3,(H,13,14)
SMILES:CCC(C(=O)O)Oc1cccc(C)c1C
Synonyms:- Butanoic Acid, 2-(2,3-Dimethylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.