CAS 33471-40-8

4-Methyl-3(2H)-pyridazinone

Description:

4-Methyl-3(2H)-pyridazinone, with the CAS number 33471-40-8, is a heterocyclic organic compound characterized by a pyridazinone ring structure. This compound features a methyl group at the 4-position and a carbonyl group at the 3-position of the pyridazine ring, contributing to its unique chemical properties. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carbonyl group makes it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, 4-Methyl-3(2H)-pyridazinone may exhibit biological activity, making it of interest in pharmaceutical research. Its stability under standard conditions allows for its use in various applications, including as an intermediate in organic synthesis. However, as with many chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₅H₆N₂O

InChI: InChI=1/C5H6N2O/c1-4-2-3-6-7-5(4)8/h2-3H,1H3,(H,7,8)

SMILES: Cc1ccnnc1O

Synonyms:

• 3(2H)-Pyridazinone, 4-methyl-
• 3-Pyridazinol, 4-Methyl-
• 4-Methylpyridazin-3(2H)-one
• 4-Methylpyridazin-3-ol
• 4-Methyl-2,3-Dihydropyridazin-3-One

4-Methyl-3(2H)-Pyridazinone

CAS: 33471-40-8

Formula: C₅H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 110.1139

Ref: IN-DA00BZSG

3-Hydroxy-4-methylpyridazine

CAS: 33471-40-8

3-Hydroxy-4-methylpyridazine

Purity: 97%

Molecular weight: 110.11g/mol

Ref: 54-OR304302

3-HYDROXY-4-METHYLPYRIDAZINE

CAS: 33471-40-8

Formula: C₅H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 110.116

Ref: 10-F303139

4-Methyl-3(2H)-pyridazinone

Controlled Product

CAS: 33471-40-8

Formula: C₅H₆N₂O

Color and Shape: Neat

Molecular weight: 110.114

Ref: TR-M327005