CAS 334757-72-1
:4-Amino-2-(Carboxyethyl)Amino Benzene Sulfonic Acid
Description:
4-Amino-2-(Carboxyethyl)Amino Benzene Sulfonic Acid, also known by its CAS number 334757-72-1, is an organic compound characterized by the presence of an amino group, a carboxyethyl side chain, and a sulfonic acid functional group attached to a benzene ring. This compound typically exhibits properties such as high solubility in water due to the presence of the sulfonic acid group, which enhances its ionic character. It is likely to be a zwitterionic substance, possessing both positive and negative charges at physiological pH, which can influence its behavior in biological systems. The amino and carboxylic acid functionalities suggest potential applications in biochemistry, particularly in the synthesis of dyes, pharmaceuticals, or as a biochemical reagent. Additionally, the sulfonic acid group may impart strong acidity, making it useful in various chemical reactions. Overall, this compound's unique structure and functional groups contribute to its reactivity and potential applications in various fields, including medicinal chemistry and materials science.
Formula:C9H12N2O5S
InChI:InChI=1/C9H12N2O5S/c1-5(9(12)13)11-7-4-6(10)2-3-8(7)17(14,15)16/h2-5,11H,10H2,1H3,(H,12,13)(H,14,15,16)
InChI key:YLVKVGAKZMEMIU-UHFFFAOYSA-N
SMILES:CC(C(=O)O)Nc1cc(ccc1S(=O)(=O)O)N
Synonyms:- 2-beta-Carboxyethylamino-4-aminobenzenesulfonicacid
- N-(5-Amino-2-sulfophenyl)-beta-alanine
- 2-Beta-Carboxyethylamino-4-Aminobenzenesulfonicacid,99%
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery