CAS 334792-52-8
:Methyl 3-bromo-5-fluorobenzoate
Description:
Methyl 3-bromo-5-fluorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both bromine and fluorine atoms, as well as a methoxycarbonyl group (the ester functional group). The presence of the bromine and fluorine substituents contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the compound's safety profile should be considered, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Proper handling and disposal procedures are essential when working with such substances in a laboratory setting.
Formula:C8H6BrFO2
InChI:InChI=1S/C8H6BrFO2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3
InChI key:InChIKey=JERAACCIOWRRQA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(Br)=CC(F)=C1
Synonyms:- 3-Bromo-5-fluorobenzoic acid methyl ester
- Benzoic acid, 3-bromo-5-fluoro-, methyl ester
- Methyl 3-bromo-5-fluorobenzoate
- Methyl 3-bromo-5-fluorobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 3-bromo-5-fluorobenzoate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H6BrFO2Purity:98%Color and Shape:Liquid, Clear colorless to pale yellowMolecular weight:233.04Methyl 3-bromo-5-fluorobenzoate
CAS:Formula:C8H6BrFO2Purity:97%Color and Shape:LiquidMolecular weight:233.0344Methyl 3-Bromo-5-fluorobenzoate
CAS:Methyl 3-Bromo-5-fluorobenzoatePurity:97%Molecular weight:233.03g/molMethyl 3-bromo-5-fluorobenzoate
CAS:Formula:C8H6BrFO2Purity:98%Color and Shape:LiquidMolecular weight:233.036Methyl 3-bromo-5-fluorobenzoate
CAS:Versatile small molecule scaffoldFormula:C8H6BrFO2Purity:Min. 95%Molecular weight:233.03 g/mol




