CAS 3349-60-8
:2,3-Dihydro-1H-inden-1-one oxime
Description:
2,3-Dihydro-1H-inden-1-one oxime, with the CAS number 3349-60-8, is an organic compound characterized by its oxime functional group attached to a bicyclic structure. This compound features a five-membered ring fused to a six-membered ring, which contributes to its unique chemical properties. Typically, it appears as a solid or viscous liquid, depending on the specific conditions. The presence of the oxime group (-C=N-OH) indicates that it can participate in various chemical reactions, such as condensation and rearrangement, making it a versatile intermediate in organic synthesis. Its reactivity is influenced by the electron-withdrawing nature of the carbonyl group in the bicyclic structure, which can enhance nucleophilic attack at the oxime nitrogen. Additionally, 2,3-Dihydro-1H-inden-1-one oxime may exhibit biological activity, although specific applications or effects would depend on further research. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c11-10-9-6-5-7-3-1-2-4-8(7)9/h1-4,11H,5-6H2
InChI key:InChIKey=ATEGUFMEFAGONB-UHFFFAOYSA-N
SMILES:N(O)=C1C=2C(CC1)=CC=CC2
Synonyms:- 1-Indanone, oxime
- 1H-inden-1-one, 2,3-dihydro-, oxime
- 2,3-Dihydro-1H-inden-1-one oxime
- N-Hydroxyindan-1-imine
- NSC 186236
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Indan-1-one oxime
CAS:Indan-1-one oximeFormula:C9H9NOPurity:≥95%Color and Shape: white crystalline solidMolecular weight:147.17g/mol1-Indanone oxime
CAS:1-Indanone oxime is a sulfonylating agent that reacts with primary amines to produce sulfonylureas. It is a model system for the study of chemical diversity and isozymes. 1-Indanone oxime has been shown to be an efficient synthetic agent for preparing hydroxyl compounds and oxime derivatives, and can be used to synthesize chlorides, secondary amines, and tertiary amines. The reaction time required for this chemical is shorter than other reagents such as sodium hypochlorite or nitrous acid. The reaction solution can be used in the synthesis of hydrochloric acid, nitric acid, chloroform, and vinyl chloride. 1-Indanone oxime has also been used to produce amino acids such as L-tryptophan or L-tyrosine.
Formula:C9H9NOPurity:Min. 95%Molecular weight:147.18 g/mol





