
CAS 33494-48-3
:Phenol, 2-(2-cyclopropylethyl)-
Description:
Phenol, 2-(2-cyclopropylethyl)-, also known by its CAS number 33494-48-3, is an organic compound characterized by a phenolic structure with a cyclopropyl ethyl substituent. This compound features a hydroxyl group (-OH) attached to a benzene ring, which imparts typical phenolic properties such as acidity and the ability to form hydrogen bonds. The presence of the cyclopropyl ethyl group introduces unique steric and electronic effects, potentially influencing its reactivity and solubility. Generally, phenolic compounds exhibit moderate to high boiling points due to hydrogen bonding and can be soluble in organic solvents. They may also demonstrate antimicrobial properties and are often used in various chemical syntheses and as intermediates in the production of pharmaceuticals and agrochemicals. The specific characteristics, such as melting point, boiling point, and reactivity, can vary based on the molecular structure and substituents, making it essential to consult detailed chemical databases or literature for precise information regarding this compound.
Formula:C11H14O
InChI:InChI=1S/C11H14O/c12-11-4-2-1-3-10(11)8-7-9-5-6-9/h1-4,9,12H,5-8H2
InChI key:InChIKey=RHOBYYGFRKZCKO-UHFFFAOYSA-N
SMILES:C(CC1CC1)C2=C(O)C=CC=C2
Synonyms:- Phenol, o-(2-cyclopropylethyl)-
- 2-(2-Cyclopropylethyl)phenol
- Phenol, 2-(2-cyclopropylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
