CAS 334952-09-9

2-oxo-2,3-dihydro-1H-indole-6-carboxylic acid

Description:

2-Oxo-2,3-dihydro-1H-indole-6-carboxylic acid, with the CAS number 334952-09-9, is a chemical compound that features a bicyclic indole structure. This compound is characterized by the presence of a carboxylic acid functional group and a ketone group, which contribute to its reactivity and potential biological activity. The indole ring system is known for its role in various natural products and pharmaceuticals, often exhibiting significant pharmacological properties. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. Its unique structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may participate in various chemical reactions, such as esterification or amidation, due to its functional groups. Overall, 2-oxo-2,3-dihydro-1H-indole-6-carboxylic acid represents a versatile scaffold for further chemical modifications and applications in drug development.

Formula: C₉H₇NO₃

InChI: InChI=1/C9H7NO3/c11-8-4-5-1-2-6(9(12)13)3-7(5)10-8/h1-3H,4H2,(H,10,11)(H,12,13)

SMILES: c1cc(cc2c1CC(=N2)O)C(=O)O

Synonyms:

• 1H-Indole-6-carboxylic acid, 2,3-dihydro-2-oxo-
• 2-Oxoindoline-6-carboxylic acid

2-oxo-2,3-dihydro-1H-indole-6-carboxylic acid

CAS: 334952-09-9

Formula: C₉H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 177.1568

Ref: IN-DA00BY6A

6-Carboxyoxindole

CAS: 334952-09-9

6-Carboxyoxindole

Purity: 98%

Molecular weight: 177.16g/mol

Ref: 54-OR910478

2-Oxoindoline-6-carboxylic acid

CAS: 334952-09-9

Formula: C₉H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 177.159

Ref: 10-F318000

6-Carboxyoxindole

CAS: 334952-09-9

Formula: C₉H₇NO₃

Molecular weight: 177.16

Ref: ST-EA-CP-N24044