CAS 334999-32-5
:1,2-Pyrrolidinedicarboxylic acid, 4-amino-, 1-(1,1-dimethylethyl) 2-methyl ester, hydrochloride (1:1), (2S,4R)-
Description:
1,2-Pyrrolidinedicarboxylic acid, 4-amino-, 1-(1,1-dimethylethyl) 2-methyl ester, hydrochloride (1:1), (2S,4R)- is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring with two carboxylic acid groups and an amino group, which contribute to its potential as a bioactive molecule. The presence of the tert-butyl group and a methyl ester enhances its lipophilicity, influencing its solubility and permeability in biological systems. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. The compound's stereochemistry, indicated by the (2S,4R) configuration, is crucial for its biological activity, as stereoisomers can exhibit significantly different properties. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in areas related to amino acid derivatives or as a building block in drug synthesis. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C11H20N2O4·ClH
InChI:InChI=1S/C11H20N2O4.ClH/c1-11(2,3)17-10(15)13-6-7(12)5-8(13)9(14)16-4;/h7-8H,5-6,12H2,1-4H3;1H/t7-,8+;/m1./s1
InChI key:InChIKey=KFYCQKLSGMAVQH-WLYNEOFISA-N
SMILES:C(OC(C)(C)C)(=O)N1[C@H](C(OC)=O)C[C@@H](N)C1.Cl
Synonyms:- (2S,4R)-4-Amino-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid methyl ester hydrochloride
- (3R,5S)-1-(tert-butoxycarbonyl)-5-(methoxycarbonyl)pyrrolidin-3-aminium
- 1,2-Pyrrolidinedicarboxylic acid, 4-amino-, 1-(1,1-dimethylethyl) 2-methyl ester, hydrochloride (1:1), (2S,4R)-
- 1,2-Pyrrolidinedicarboxylic acid, 4-amino-, 1-(1,1-dimethylethyl) 2-methyl ester, monohydrochloride, (2S,4R)-
- 1-tert-Butyl 2-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
trans-4-Amino-N-Boc-L-proline methyl ester hydrochloride, 97%
CAS:trans-4-Amino-N-Boc-L-proline methyl ester hydrochloride acts as a pharmaceutical intermediate. It is used to prepare N-Boc-protected proline methyl ester of calix[4]arene, which is efficiently catalyzes the enantioselective aldol reaction. This Thermo Scientific Chemicals brand product was original
Formula:C11H20N2O4•HClPurity:97%Molecular weight:280.75N-Boc-trans-4-amino-L-proline methyl ester HCl
CAS:Formula:C11H21ClN2O4Purity:96%Color and Shape:SolidMolecular weight:280.7484Methyl (2S,4R)-4-aminopyrrolidine-2-carboxylate hydrochloride, N1-BOC protected
CAS:Methyl (2S,4R)-4-aminopyrrolidine-2-carboxylate hydrochloride, N1-BOC protectedFormula:C11H20N2O4·ClHPurity:≥95%Color and Shape: white powderMolecular weight:280.75g/mol(2S,4R)-1-Boc-4-amino-L-proline methyl ester hydrochloride
CAS:Formula:C11H21ClN2O4Purity:96%Color and Shape:SolidMolecular weight:280.75



