CAS 335032-57-0

Methyl 6-methoxy-1-methyl-1H-indole-2-carboxylate

Description:

Methyl 6-methoxy-1-methyl-1H-indole-2-carboxylate, identified by its CAS number 335032-57-0, is a chemical compound belonging to the indole family, which is characterized by a bicyclic structure containing a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features a methoxy group and a methyl group, which contribute to its unique chemical properties and reactivity. It is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or other bioactive compounds. The presence of the carboxylate group suggests potential for further functionalization, making it a versatile building block in medicinal chemistry. Additionally, its structural features may influence its biological activity, including interactions with various biological targets. As with many indole derivatives, it may exhibit interesting pharmacological properties, although specific biological activities would require empirical investigation. Proper handling and safety measures should be observed due to the potential hazards associated with chemical substances.

Formula: C₁₂H₁₃NO₃

InChI: InChI=1S/C12H13NO3/c1-13-10-7-9(15-2)5-4-8(10)6-11(13)12(14)16-3/h4-7H,1-3H3

InChI key: InChIKey=SRWZUDVDLGGWIH-UHFFFAOYSA-N

SMILES: CN1C=2C(C=C1C(OC)=O)=CC=C(OC)C2

Synonyms:

• 6-Methoxy-1-methyl-1H-indole-2-carboxylic acid methyl ester
• Methyl 6-methoxy-1-methyl-1H-indole-2-carboxylate
• 1H-Indole-2-carboxylic acid, 6-methoxy-1-methyl-, methyl ester