CAS 335032-69-4
:1,5-dimethyl-1H-indole-3-carbaldehyde
Description:
1,5-Dimethyl-1H-indole-3-carbaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features two methyl groups at the 1 and 5 positions of the indole ring and an aldehyde functional group at the 3 position. The presence of the aldehyde group contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and oxidation. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, the presence of the dimethyl groups can influence its electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. As with many indole derivatives, it may also exhibit biological activity, warranting further investigation into its potential uses in medicinal chemistry.
Formula:C11H11NO
InChI:InChI=1/C11H11NO/c1-8-3-4-11-10(5-8)9(7-13)6-12(11)2/h3-7H,1-2H3
SMILES:Cc1ccc2c(c1)c(cn2C)C=O
Synonyms:- 1H-Indole-3-carbaldehyde, 1,5-dimethyl-
- 1H-indole-3-carboxaldehyde, 1,5-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,5-Dimethyl-1H-indole-3-carbaldehyde
CAS:1,5-Dimethyl-1H-indole-3-carbaldehydePurity:97%Molecular weight:173.22g/mol1,5-Dimethyl-1H-indole-3-carbaldehyde
CAS:1,5-Dimethyl-1H-indole-3-carbaldehyde is a useful building block for organic synthesis. It is an important reagent for the synthesis of complex compounds and it has been used as a versatile building block in organic chemistry. This compound can be used as a starting point for the preparation of other chemicals, such as pharmaceuticals, pesticides, and dyes. 1,5-Dimethyl-1H-indole-3-carbaldehyde is also a fine chemical that has been used for research purposes. There are no known commercial uses for this compound.Formula:C11H11NOPurity:Min. 95%Color and Shape:PowderMolecular weight:173.21 g/mol1,5-dimethyl-1H-indole-3-carbaldehyde
CAS:Formula:C11H11NOPurity:97%Color and Shape:SolidMolecular weight:173.215



