CAS 33507-82-3
:(R,R)-(+)-1,4-dimethoxy-2,3-butanediol
Description:
(R,R)-(+)-1,4-dimethoxy-2,3-butanediol, with the CAS number 33507-82-3, is a chiral organic compound characterized by its specific stereochemistry, which contributes to its unique properties and potential applications. This compound features two methoxy groups and two hydroxyl groups, making it a diol. The presence of these functional groups suggests that it may exhibit solubility in polar solvents and could participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The (R,R) configuration indicates that both chiral centers are in the R configuration, which can affect the compound's biological activity and interactions in chiral environments. This compound may be of interest in the synthesis of pharmaceuticals or as an intermediate in organic synthesis due to its functional groups and stereochemical properties. Additionally, its potential applications in various fields, including medicinal chemistry and materials science, highlight the importance of understanding its characteristics and behavior in different chemical contexts.
Formula:C6H14O4
InChI:InChI=1/C6H14O4/c1-9-3-5(7)6(8)4-10-2/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1
SMILES:COC[C@H]([C@@H](COC)O)O
Synonyms:- (2R,3R)-1,4-dimethoxybutane-2,3-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(R,R)-(+)-1,4-Dimethoxy-2,3-butanediol
CAS:<p>(R,R)-(+)-1,4-Dimethoxy-2,3-butanediol is a modification of the sugar 1,4-dimethoxy-2,3-butanediol. It is a carbohydrate that can be synthesized and purified to high purity. The synthesis of (R,R)-(+)-1,4-dimethoxy-2,3-butanediol starts with the methylation of glycerol followed by the addition of an alpha hydroxyl group. The final product is produced by glycosylation and polysaccharide synthesis. This modification has been shown to be effective in treating cancer cells and may have potential applications in other areas as well.</p>Formula:C6H14O4Purity:Min. 95%Molecular weight:150.17 g/mol
