CAS 335161-27-8
:[1-(5-Fluoropentyl)-6-nitro-1H-indol-3-yl]-1-naphthalenylmethanone
Description:
The chemical substance known as [1-(5-Fluoropentyl)-6-nitro-1H-indol-3-yl]-1-naphthalenylmethanone, with the CAS number 335161-27-8, is a synthetic compound that belongs to the class of indole derivatives. It features a complex structure characterized by the presence of a fluoropentyl chain and a nitro group, which contribute to its unique chemical properties. The indole moiety is known for its biological activity, often interacting with various receptors in the body. This compound may exhibit psychoactive effects, similar to other indole-based substances, and is of interest in research related to cannabinoid receptors. Its molecular structure suggests potential lipophilicity, which could influence its solubility and bioavailability. Additionally, the presence of both the naphthalenyl and indole components may enhance its interaction with biological targets. As with many synthetic compounds, safety and toxicity profiles are crucial for understanding its potential applications and risks. Further studies are necessary to elucidate its pharmacological effects and mechanisms of action.
Formula:C24H21FN2O3
InChI:InChI=1S/C24H21FN2O3/c25-13-4-1-5-14-26-16-22(20-12-11-18(27(29)30)15-23(20)26)24(28)21-10-6-8-17-7-2-3-9-19(17)21/h2-3,6-12,15-16H,1,4-5,13-14H2
InChI key:InChIKey=LNGVQORPSNNMSZ-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=2C(N(CCCCCF)C1)=CC(N(=O)=O)=CC2)C=3C4=C(C=CC3)C=CC=C4
Synonyms:- Methanone, [1-(5-fluoropentyl)-6-nitro-1H-indol-3-yl]-1-naphthalenyl-
- [1-(5-Fluoropentyl)-6-nitroindol-3-yl]-naphthalen-1-ylmethanone
- [1-(5-Fluoropentyl)-6-nitro-1H-indol-3-yl]-1-naphthalenylmethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
AM 1235
CAS:Controlled ProductAM 1235 is a synthetic cannabinoid with cannabimimetic properties. It has affinity for the CB2 receptor, which is found in host plants, bryophytes, and animals. AM 1235 has been shown to inhibit the frequency of re-epithelialisation in an animal model of glaucoma. This drug also binds to the plasma concentration of medications such as buprenorphine and ketamine. AM 1235 inhibits the activity of acetylcholinesterase enzymes by acting on their active site, preventing them from breaking down acetylcholine. This leads to increased levels of acetylcholine in synapses and causes a variety of effects such as memory impairment and convulsions.Purity:Min. 95%AM-1235
CAS:AM-1235 is a potent and selective cannabinoid receptor CB1 agonist.Formula:C24H21FN2O3Purity:99.92%Color and Shape:SolidMolecular weight:404.43


